C11H15FO2 — CID 91020266
1-(1-fluoropropyl)-2,3-dimethoxybenzene (PubChem CID 91020266) has the molecular formula C11H15FO2 and a molecular weight of 198.24 g/mol. Its IUPAC name is 1-(1-fluoropropyl)-2,3-dimethoxybenzene.
| Compound Name | 1-(1-fluoropropyl)-2,3-dimethoxybenzene |
|---|---|
| PubChem CID | 91020266 |
| Molecular Formula | C11H15FO2 |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 1-(1-fluoropropyl)-2,3-dimethoxybenzene |
| SMILES | CCC(F)c1cccc(OC)c1OC |
| InChI | InChI=1S/C11H15FO2/c1-4-9(12)8-6-5-7-10(13-2)11(8)14-3/h5-7,9H,4H2,1-3H3 |
| InChIKey | PXTGCLXJAYVLRM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |