C10H12F3NO2 — CID 66510258
(1S)-1-(2,3-dimethoxyphenyl)-2,2,2-trifluoroethanamine (PubChem CID 66510258) has the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. Its IUPAC name is (1S)-1-(2,3-dimethoxyphenyl)-2,2,2-trifluoroethanamine.
| Compound Name | (1S)-1-(2,3-dimethoxyphenyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 66510258 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | (1S)-1-(2,3-dimethoxyphenyl)-2,2,2-trifluoroethanamine |
| SMILES | COc1cccc([C@H](N)C(F)(F)F)c1OC |
| InChI | InChI=1S/C10H12F3NO2/c1-15-7-5-3-4-6(8(7)16-2)9(14)10(11,12)13/h3-5,9H,14H2,1-2H3/t9-/m0/s1 |
| InChIKey | KYTLOKGMNHPXNX-VIFPVBQESA-N |
| XLogP | 2.27 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |