C11H15ClO4S — CID 115790708
1-(5-chloro-2-methoxyphenyl)-3-methylsulfonylpropan-1-ol (PubChem CID 115790708) has the molecular formula C11H15ClO4S and a molecular weight of 278.76 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-methylsulfonylpropan-1-ol.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-methylsulfonylpropan-1-ol |
|---|---|
| PubChem CID | 115790708 |
| Molecular Formula | C11H15ClO4S |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-methylsulfonylpropan-1-ol |
| SMILES | COc1ccc(Cl)cc1C(O)CCS(C)(=O)=O |
| InChI | InChI=1S/C11H15ClO4S/c1-16-11-4-3-8(12)7-9(11)10(13)5-6-17(2,14)15/h3-4,7,10,13H,5-6H2,1-2H3 |
| InChIKey | MUQIZSJXCJCMBI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |