C13H20O6S — CID 65148029
3-methylsulfonyl-1-(2,4,5-trimethoxyphenyl)propan-1-ol (PubChem CID 65148029) has the molecular formula C13H20O6S and a molecular weight of 304.36 g/mol. Its IUPAC name is 3-methylsulfonyl-1-(2,4,5-trimethoxyphenyl)propan-1-ol.
| Compound Name | 3-methylsulfonyl-1-(2,4,5-trimethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 65148029 |
| Molecular Formula | C13H20O6S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-methylsulfonyl-1-(2,4,5-trimethoxyphenyl)propan-1-ol |
| SMILES | COc1cc(OC)c(C(O)CCS(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C13H20O6S/c1-17-11-8-13(19-3)12(18-2)7-9(11)10(14)5-6-20(4,15)16/h7-8,10,14H,5-6H2,1-4H3 |
| InChIKey | SWBWDXZTYSQZRQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |