C13H17F3O3 — CID 103449289
2-ethyl-1-[2-(trifluoromethoxy)phenyl]butane-1,2-diol (PubChem CID 103449289) has the molecular formula C13H17F3O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 2-ethyl-1-[2-(trifluoromethoxy)phenyl]butane-1,2-diol.
| Compound Name | 2-ethyl-1-[2-(trifluoromethoxy)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 103449289 |
| Molecular Formula | C13H17F3O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-ethyl-1-[2-(trifluoromethoxy)phenyl]butane-1,2-diol |
| SMILES | CCC(O)(CC)C(O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H17F3O3/c1-3-12(18,4-2)11(17)9-7-5-6-8-10(9)19-13(14,15)16/h5-8,11,17-18H,3-4H2,1-2H3 |
| InChIKey | DEHSPAXCMCIHRV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |