C13H18F2O4S — CID 115803658
1-[3-(difluoromethoxy)phenyl]-4-ethylsulfonylbutan-1-ol (PubChem CID 115803658) has the molecular formula C13H18F2O4S and a molecular weight of 308.35 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-4-ethylsulfonylbutan-1-ol.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-4-ethylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 115803658 |
| Molecular Formula | C13H18F2O4S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-4-ethylsulfonylbutan-1-ol |
| SMILES | CCS(=O)(=O)CCCC(O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C13H18F2O4S/c1-2-20(17,18)8-4-7-12(16)10-5-3-6-11(9-10)19-13(14)15/h3,5-6,9,12-13,16H,2,4,7-8H2,1H3 |
| InChIKey | YSTJJZNZJGOEIZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |