C12H14F2O2 — CID 115804584
1-[3-(difluoromethoxy)phenyl]pent-4-en-1-ol (PubChem CID 115804584) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]pent-4-en-1-ol.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]pent-4-en-1-ol |
|---|---|
| PubChem CID | 115804584 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]pent-4-en-1-ol |
| SMILES | C=CCCC(O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C12H14F2O2/c1-2-3-7-11(15)9-5-4-6-10(8-9)16-12(13)14/h2,4-6,8,11-12,15H,1,3,7H2 |
| InChIKey | QRIXOABVHCUXQS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|