C15H23BrO3S — CID 66041761
1-[2-(bromomethyl)-5-ethylsulfonylpentyl]-2-methoxybenzene (PubChem CID 66041761) has the molecular formula C15H23BrO3S and a molecular weight of 363.32 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-5-ethylsulfonylpentyl]-2-methoxybenzene.
| Compound Name | 1-[2-(bromomethyl)-5-ethylsulfonylpentyl]-2-methoxybenzene |
|---|---|
| PubChem CID | 66041761 |
| Molecular Formula | C15H23BrO3S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 1-[2-(bromomethyl)-5-ethylsulfonylpentyl]-2-methoxybenzene |
| SMILES | CCS(=O)(=O)CCCC(CBr)Cc1ccccc1OC |
| InChI | InChI=1S/C15H23BrO3S/c1-3-20(17,18)10-6-7-13(12-16)11-14-8-4-5-9-15(14)19-2/h4-5,8-9,13H,3,6-7,10-12H2,1-2H3 |
| InChIKey | QKJWEGBGZXXYGB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|