C15H24O4S — CID 106734391
2-[(2-methoxyphenyl)methyl]-4-propylsulfonylbutan-1-ol (PubChem CID 106734391) has the molecular formula C15H24O4S and a molecular weight of 300.42 g/mol. Its IUPAC name is 2-[(2-methoxyphenyl)methyl]-4-propylsulfonylbutan-1-ol.
| Compound Name | 2-[(2-methoxyphenyl)methyl]-4-propylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 106734391 |
| Molecular Formula | C15H24O4S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[(2-methoxyphenyl)methyl]-4-propylsulfonylbutan-1-ol |
| SMILES | CCCS(=O)(=O)CCC(CO)Cc1ccccc1OC |
| InChI | InChI=1S/C15H24O4S/c1-3-9-20(17,18)10-8-13(12-16)11-14-6-4-5-7-15(14)19-2/h4-7,13,16H,3,8-12H2,1-2H3 |
| InChIKey | GVVGHAVZBZXSBT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |