C14H21FO3S — CID 106734373
2-[(3-fluorophenyl)methyl]-4-propylsulfonylbutan-1-ol (PubChem CID 106734373) has the molecular formula C14H21FO3S and a molecular weight of 288.38 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-4-propylsulfonylbutan-1-ol.
| Compound Name | 2-[(3-fluorophenyl)methyl]-4-propylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 106734373 |
| Molecular Formula | C14H21FO3S |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-4-propylsulfonylbutan-1-ol |
| SMILES | CCCS(=O)(=O)CCC(CO)Cc1cccc(F)c1 |
| InChI | InChI=1S/C14H21FO3S/c1-2-7-19(17,18)8-6-13(11-16)9-12-4-3-5-14(15)10-12/h3-5,10,13,16H,2,6-9,11H2,1H3 |
| InChIKey | BMKZFWIMOQNSTC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |