C14H21BrO3S — CID 66039051
2-[(2-bromophenyl)methyl]-5-ethylsulfonylpentan-1-ol (PubChem CID 66039051) has the molecular formula C14H21BrO3S and a molecular weight of 349.29 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methyl]-5-ethylsulfonylpentan-1-ol.
| Compound Name | 2-[(2-bromophenyl)methyl]-5-ethylsulfonylpentan-1-ol |
|---|---|
| PubChem CID | 66039051 |
| Molecular Formula | C14H21BrO3S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-[(2-bromophenyl)methyl]-5-ethylsulfonylpentan-1-ol |
| SMILES | CCS(=O)(=O)CCCC(CO)Cc1ccccc1Br |
| InChI | InChI=1S/C14H21BrO3S/c1-2-19(17,18)9-5-6-12(11-16)10-13-7-3-4-8-14(13)15/h3-4,7-8,12,16H,2,5-6,9-11H2,1H3 |
| InChIKey | GNKXMROBUNWRQF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |