C13H19ClO3S — CID 66058467
2-[(2-chlorophenyl)methyl]-5-methylsulfonylpentan-1-ol (PubChem CID 66058467) has the molecular formula C13H19ClO3S and a molecular weight of 290.81 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-5-methylsulfonylpentan-1-ol.
| Compound Name | 2-[(2-chlorophenyl)methyl]-5-methylsulfonylpentan-1-ol |
|---|---|
| PubChem CID | 66058467 |
| Molecular Formula | C13H19ClO3S |
| Molecular Weight | 290.81 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-5-methylsulfonylpentan-1-ol |
| SMILES | CS(=O)(=O)CCCC(CO)Cc1ccccc1Cl |
| InChI | InChI=1S/C13H19ClO3S/c1-18(16,17)8-4-5-11(10-15)9-12-6-2-3-7-13(12)14/h2-3,6-7,11,15H,4-5,8-10H2,1H3 |
| InChIKey | WSIBVNFFZUSDEC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.81 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |