C15H24ClNO2S — CID 106729759
2-[(2-chlorophenyl)methyl]-N-methyl-4-propan-2-ylsulfonylbutan-1-amine (PubChem CID 106729759) has the molecular formula C15H24ClNO2S and a molecular weight of 317.88 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-N-methyl-4-propan-2-ylsulfonylbutan-1-amine.
| Compound Name | 2-[(2-chlorophenyl)methyl]-N-methyl-4-propan-2-ylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 106729759 |
| Molecular Formula | C15H24ClNO2S |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-N-methyl-4-propan-2-ylsulfonylbutan-1-amine |
| SMILES | CNCC(CCS(=O)(=O)C(C)C)Cc1ccccc1Cl |
| InChI | InChI=1S/C15H24ClNO2S/c1-12(2)20(18,19)9-8-13(11-17-3)10-14-6-4-5-7-15(14)16/h4-7,12-13,17H,8-11H2,1-3H3 |
| InChIKey | WENZKIBNADKKMC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |