C19H32ClN — CID 83148905
2-[(2-chlorophenyl)methyl]-6-methyl-N-(2-methylpropyl)heptan-1-amine (PubChem CID 83148905) has the molecular formula C19H32ClN and a molecular weight of 309.93 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-6-methyl-N-(2-methylpropyl)heptan-1-amine.
| Compound Name | 2-[(2-chlorophenyl)methyl]-6-methyl-N-(2-methylpropyl)heptan-1-amine |
|---|---|
| PubChem CID | 83148905 |
| Molecular Formula | C19H32ClN |
| Molecular Weight | 309.93 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-6-methyl-N-(2-methylpropyl)heptan-1-amine |
| SMILES | CC(C)CCCC(CNCC(C)C)Cc1ccccc1Cl |
| InChI | InChI=1S/C19H32ClN/c1-15(2)8-7-9-17(14-21-13-16(3)4)12-18-10-5-6-11-19(18)20/h5-6,10-11,15-17,21H,7-9,12-14H2,1-4H3 |
| InChIKey | JYGMFBNVBXVTPO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.93 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |