C19H32ClN — CID 63521234
2-[(2-chlorophenyl)methyl]-N-methylundecan-1-amine (PubChem CID 63521234) has the molecular formula C19H32ClN and a molecular weight of 309.92 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-N-methylundecan-1-amine.
| Compound Name | 2-[(2-chlorophenyl)methyl]-N-methylundecan-1-amine |
|---|---|
| PubChem CID | 63521234 |
| Molecular Formula | C19H32ClN |
| Molecular Weight | 309.92 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-N-methylundecan-1-amine |
| SMILES | CCCCCCCCCC(CNC)Cc1ccccc1Cl |
| InChI | InChI=1S/C19H32ClN/c1-3-4-5-6-7-8-9-12-17(16-21-2)15-18-13-10-11-14-19(18)20/h10-11,13-14,17,21H,3-9,12,15-16H2,1-2H3 |
| InChIKey | RSYDISCCCQXHGQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.92 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|