C18H28ClN — CID 63522844
N-[2-[(2-chlorophenyl)methyl]octyl]cyclopropanamine (PubChem CID 63522844) has the molecular formula C18H28ClN and a molecular weight of 293.88 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)methyl]octyl]cyclopropanamine.
| Compound Name | N-[2-[(2-chlorophenyl)methyl]octyl]cyclopropanamine |
|---|---|
| PubChem CID | 63522844 |
| Molecular Formula | C18H28ClN |
| Molecular Weight | 293.88 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N-[2-[(2-chlorophenyl)methyl]octyl]cyclopropanamine |
| SMILES | CCCCCCC(CNC1CC1)Cc1ccccc1Cl |
| InChI | InChI=1S/C18H28ClN/c1-2-3-4-5-8-15(14-20-17-11-12-17)13-16-9-6-7-10-18(16)19/h6-7,9-10,15,17,20H,2-5,8,11-14H2,1H3 |
| InChIKey | VFLWCNWGQGREMG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.88 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|