C13H18Br2O — CID 63435538
4-bromo-2-(1-bromo-3,3-dimethylbutyl)-1-methoxybenzene (PubChem CID 63435538) has the molecular formula C13H18Br2O and a molecular weight of 350.09 g/mol. Its IUPAC name is 4-bromo-2-(1-bromo-3,3-dimethylbutyl)-1-methoxybenzene.
| Compound Name | 4-bromo-2-(1-bromo-3,3-dimethylbutyl)-1-methoxybenzene |
|---|---|
| PubChem CID | 63435538 |
| Molecular Formula | C13H18Br2O |
| Molecular Weight | 350.09 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 4-bromo-2-(1-bromo-3,3-dimethylbutyl)-1-methoxybenzene |
| SMILES | COc1ccc(Br)cc1C(Br)CC(C)(C)C |
| InChI | InChI=1S/C13H18Br2O/c1-13(2,3)8-11(15)10-7-9(14)5-6-12(10)16-4/h5-7,11H,8H2,1-4H3 |
| InChIKey | KKOHHSCRMNBFAL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.09 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|