C15H23BrO2 — CID 63832427
1-(5-bromo-2-methoxyphenyl)-3,4,4-trimethylpentan-1-ol (PubChem CID 63832427) has the molecular formula C15H23BrO2 and a molecular weight of 315.25 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-3,4,4-trimethylpentan-1-ol.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-3,4,4-trimethylpentan-1-ol |
|---|---|
| PubChem CID | 63832427 |
| Molecular Formula | C15H23BrO2 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-3,4,4-trimethylpentan-1-ol |
| SMILES | COc1ccc(Br)cc1C(O)CC(C)C(C)(C)C |
| InChI | InChI=1S/C15H23BrO2/c1-10(15(2,3)4)8-13(17)12-9-11(16)6-7-14(12)18-5/h6-7,9-10,13,17H,8H2,1-5H3 |
| InChIKey | ACCPWTQTPFUCCO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |