C11H14BrClO4 — CID 171861224
3-bromo-1-(2-chloro-3,4-dimethoxyphenyl)propane-1,2-diol (PubChem CID 171861224) has the molecular formula C11H14BrClO4 and a molecular weight of 325.59 g/mol. Its IUPAC name is 3-bromo-1-(2-chloro-3,4-dimethoxyphenyl)propane-1,2-diol.
| Compound Name | 3-bromo-1-(2-chloro-3,4-dimethoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171861224 |
| Molecular Formula | C11H14BrClO4 |
| Molecular Weight | 325.59 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 3-bromo-1-(2-chloro-3,4-dimethoxyphenyl)propane-1,2-diol |
| SMILES | COc1ccc(C(O)C(O)CBr)c(Cl)c1OC |
| InChI | InChI=1S/C11H14BrClO4/c1-16-8-4-3-6(9(13)11(8)17-2)10(15)7(14)5-12/h3-4,7,10,14-15H,5H2,1-2H3 |
| InChIKey | OXSBPVFAAXWRPE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.59 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|