C13H19ClO4 — CID 79566842
1-(2-chloro-3,4-dimethoxyphenyl)-2-propan-2-yloxyethanol (PubChem CID 79566842) has the molecular formula C13H19ClO4 and a molecular weight of 274.74 g/mol. Its IUPAC name is 1-(2-chloro-3,4-dimethoxyphenyl)-2-propan-2-yloxyethanol.
| Compound Name | 1-(2-chloro-3,4-dimethoxyphenyl)-2-propan-2-yloxyethanol |
|---|---|
| PubChem CID | 79566842 |
| Molecular Formula | C13H19ClO4 |
| Molecular Weight | 274.74 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(2-chloro-3,4-dimethoxyphenyl)-2-propan-2-yloxyethanol |
| SMILES | COc1ccc(C(O)COC(C)C)c(Cl)c1OC |
| InChI | InChI=1S/C13H19ClO4/c1-8(2)18-7-10(15)9-5-6-11(16-3)13(17-4)12(9)14/h5-6,8,10,15H,7H2,1-4H3 |
| InChIKey | UCCUIOUYYQHYAY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.74 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |