C14H24N2O4 — CID 105323684
[2-propan-2-yloxy-1-(2,3,4-trimethoxyphenyl)ethyl]hydrazine (PubChem CID 105323684) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is [2-propan-2-yloxy-1-(2,3,4-trimethoxyphenyl)ethyl]hydrazine.
| Compound Name | [2-propan-2-yloxy-1-(2,3,4-trimethoxyphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105323684 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | [2-propan-2-yloxy-1-(2,3,4-trimethoxyphenyl)ethyl]hydrazine |
| SMILES | COc1ccc(C(COC(C)C)NN)c(OC)c1OC |
| InChI | InChI=1S/C14H24N2O4/c1-9(2)20-8-11(16-15)10-6-7-12(17-3)14(19-5)13(10)18-4/h6-7,9,11,16H,8,15H2,1-5H3 |
| InChIKey | AZFMZLUBIGPLRO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|