C14H23NO4 — CID 105008034
2-ethoxy-N-methyl-1-(2,3,4-trimethoxyphenyl)ethanamine (PubChem CID 105008034) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-ethoxy-N-methyl-1-(2,3,4-trimethoxyphenyl)ethanamine.
| Compound Name | 2-ethoxy-N-methyl-1-(2,3,4-trimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 105008034 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-ethoxy-N-methyl-1-(2,3,4-trimethoxyphenyl)ethanamine |
| SMILES | CCOCC(NC)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C14H23NO4/c1-6-19-9-11(15-2)10-7-8-12(16-3)14(18-5)13(10)17-4/h7-8,11,15H,6,9H2,1-5H3 |
| InChIKey | OJIFCJOPKXCGRQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |