C14H22BrNO3 — CID 103523415
1-(3-bromo-2,4-dimethoxyphenyl)-2-ethoxy-N-ethylethanamine (PubChem CID 103523415) has the molecular formula C14H22BrNO3 and a molecular weight of 332.24 g/mol. Its IUPAC name is 1-(3-bromo-2,4-dimethoxyphenyl)-2-ethoxy-N-ethylethanamine.
| Compound Name | 1-(3-bromo-2,4-dimethoxyphenyl)-2-ethoxy-N-ethylethanamine |
|---|---|
| PubChem CID | 103523415 |
| Molecular Formula | C14H22BrNO3 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 1-(3-bromo-2,4-dimethoxyphenyl)-2-ethoxy-N-ethylethanamine |
| SMILES | CCNC(COCC)c1ccc(OC)c(Br)c1OC |
| InChI | InChI=1S/C14H22BrNO3/c1-5-16-11(9-19-6-2)10-7-8-12(17-3)13(15)14(10)18-4/h7-8,11,16H,5-6,9H2,1-4H3 |
| InChIKey | YZQHZPKTBFQDGG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |