C13H20ClNO3 — CID 79575404
1-(3-chloro-4,5-dimethoxyphenyl)-2-ethoxy-N-methylethanamine (PubChem CID 79575404) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is 1-(3-chloro-4,5-dimethoxyphenyl)-2-ethoxy-N-methylethanamine.
| Compound Name | 1-(3-chloro-4,5-dimethoxyphenyl)-2-ethoxy-N-methylethanamine |
|---|---|
| PubChem CID | 79575404 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-(3-chloro-4,5-dimethoxyphenyl)-2-ethoxy-N-methylethanamine |
| SMILES | CCOCC(NC)c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C13H20ClNO3/c1-5-18-8-11(15-2)9-6-10(14)13(17-4)12(7-9)16-3/h6-7,11,15H,5,8H2,1-4H3 |
| InChIKey | KDIVHWHEXZWKQS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |