C14H21ClN2O2 — CID 105204631
[1-(3-chloro-4,5-dimethoxyphenyl)-3-methylidenepentyl]hydrazine (PubChem CID 105204631) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is [1-(3-chloro-4,5-dimethoxyphenyl)-3-methylidenepentyl]hydrazine.
| Compound Name | [1-(3-chloro-4,5-dimethoxyphenyl)-3-methylidenepentyl]hydrazine |
|---|---|
| PubChem CID | 105204631 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | [1-(3-chloro-4,5-dimethoxyphenyl)-3-methylidenepentyl]hydrazine |
| SMILES | C=C(CC)CC(NN)c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H21ClN2O2/c1-5-9(2)6-12(17-16)10-7-11(15)14(19-4)13(8-10)18-3/h7-8,12,17H,2,5-6,16H2,1,3-4H3 |
| InChIKey | QDNIKOJVDCWKKG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|