C13H19ClN2O2 — CID 105204535
[1-(3-chloro-4,5-dimethoxyphenyl)-2-cyclopropylethyl]hydrazine (PubChem CID 105204535) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is [1-(3-chloro-4,5-dimethoxyphenyl)-2-cyclopropylethyl]hydrazine.
| Compound Name | [1-(3-chloro-4,5-dimethoxyphenyl)-2-cyclopropylethyl]hydrazine |
|---|---|
| PubChem CID | 105204535 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | [1-(3-chloro-4,5-dimethoxyphenyl)-2-cyclopropylethyl]hydrazine |
| SMILES | COc1cc(C(CC2CC2)NN)cc(Cl)c1OC |
| InChI | InChI=1S/C13H19ClN2O2/c1-17-12-7-9(6-10(14)13(12)18-2)11(16-15)5-8-3-4-8/h6-8,11,16H,3-5,15H2,1-2H3 |
| InChIKey | IMLCHJCDAIMEIY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|