C16H25ClN2O2 — CID 105204608
[(3-chloro-4,5-dimethoxyphenyl)-(4-methylcyclohexyl)methyl]hydrazine (PubChem CID 105204608) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is [(3-chloro-4,5-dimethoxyphenyl)-(4-methylcyclohexyl)methyl]hydrazine.
| Compound Name | [(3-chloro-4,5-dimethoxyphenyl)-(4-methylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105204608 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [(3-chloro-4,5-dimethoxyphenyl)-(4-methylcyclohexyl)methyl]hydrazine |
| SMILES | COc1cc(C(NN)C2CCC(C)CC2)cc(Cl)c1OC |
| InChI | InChI=1S/C16H25ClN2O2/c1-10-4-6-11(7-5-10)15(19-18)12-8-13(17)16(21-3)14(9-12)20-2/h8-11,15,19H,4-7,18H2,1-3H3 |
| InChIKey | OCZKNCMNTCTDJC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|