C11H16ClNO3 — CID 79138086
3-amino-1-(2-chloro-3,4-dimethoxyphenyl)propan-1-ol (PubChem CID 79138086) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 3-amino-1-(2-chloro-3,4-dimethoxyphenyl)propan-1-ol.
| Compound Name | 3-amino-1-(2-chloro-3,4-dimethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 79138086 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 3-amino-1-(2-chloro-3,4-dimethoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(C(O)CCN)c(Cl)c1OC |
| InChI | InChI=1S/C11H16ClNO3/c1-15-9-4-3-7(8(14)5-6-13)10(12)11(9)16-2/h3-4,8,14H,5-6,13H2,1-2H3 |
| InChIKey | JGBYBBCSWPVDDV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |