C13H18ClNO4 — CID 66098501
methyl 4-amino-3-(2-chloro-3,4-dimethoxyphenyl)butanoate (PubChem CID 66098501) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is methyl 4-amino-3-(2-chloro-3,4-dimethoxyphenyl)butanoate.
| Compound Name | methyl 4-amino-3-(2-chloro-3,4-dimethoxyphenyl)butanoate |
|---|---|
| PubChem CID | 66098501 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | methyl 4-amino-3-(2-chloro-3,4-dimethoxyphenyl)butanoate |
| SMILES | COC(=O)CC(CN)c1ccc(OC)c(OC)c1Cl |
| InChI | InChI=1S/C13H18ClNO4/c1-17-10-5-4-9(12(14)13(10)19-3)8(7-15)6-11(16)18-2/h4-5,8H,6-7,15H2,1-3H3 |
| InChIKey | NHFALIUNQIFSHG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |