C14H21ClN2O3 — CID 63632739
2-(butan-2-ylamino)-2-(2-chloro-3,4-dimethoxyphenyl)acetamide (PubChem CID 63632739) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-2-(2-chloro-3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(butan-2-ylamino)-2-(2-chloro-3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 63632739 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-(butan-2-ylamino)-2-(2-chloro-3,4-dimethoxyphenyl)acetamide |
| SMILES | CCC(C)NC(C(N)=O)c1ccc(OC)c(OC)c1Cl |
| InChI | InChI=1S/C14H21ClN2O3/c1-5-8(2)17-12(14(16)18)9-6-7-10(19-3)13(20-4)11(9)15/h6-8,12,17H,5H2,1-4H3,(H2,16,18) |
| InChIKey | LVLQEVWDRIQJFI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |