C12H17ClN2O3 — CID 63627273
2-[(2-chloro-3,4-dimethoxyphenyl)methylamino]propanamide (PubChem CID 63627273) has the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. Its IUPAC name is 2-[(2-chloro-3,4-dimethoxyphenyl)methylamino]propanamide.
| Compound Name | 2-[(2-chloro-3,4-dimethoxyphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 63627273 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-[(2-chloro-3,4-dimethoxyphenyl)methylamino]propanamide |
| SMILES | COc1ccc(CNC(C)C(N)=O)c(Cl)c1OC |
| InChI | InChI=1S/C12H17ClN2O3/c1-7(12(14)16)15-6-8-4-5-9(17-2)11(18-3)10(8)13/h4-5,7,15H,6H2,1-3H3,(H2,14,16) |
| InChIKey | QCWVRVNZTJEHKF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |