C14H21ClN2O4 — CID 107236645
tert-butyl N-[(2-chloro-3,4-dimethoxyphenyl)methylamino]carbamate (PubChem CID 107236645) has the molecular formula C14H21ClN2O4 and a molecular weight of 316.79 g/mol. Its IUPAC name is tert-butyl N-[(2-chloro-3,4-dimethoxyphenyl)methylamino]carbamate.
| Compound Name | tert-butyl N-[(2-chloro-3,4-dimethoxyphenyl)methylamino]carbamate |
|---|---|
| PubChem CID | 107236645 |
| Molecular Formula | C14H21ClN2O4 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | tert-butyl N-[(2-chloro-3,4-dimethoxyphenyl)methylamino]carbamate |
| SMILES | COc1ccc(CNNC(=O)OC(C)(C)C)c(Cl)c1OC |
| InChI | InChI=1S/C14H21ClN2O4/c1-14(2,3)21-13(18)17-16-8-9-6-7-10(19-4)12(20-5)11(9)15/h6-7,16H,8H2,1-5H3,(H,17,18) |
| InChIKey | JTDOSHMTPBODQI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|