C15H24N2O5 — CID 107237065
tert-butyl N-[(3,4,5-trimethoxyphenyl)methylamino]carbamate (PubChem CID 107237065) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is tert-butyl N-[(3,4,5-trimethoxyphenyl)methylamino]carbamate.
| Compound Name | tert-butyl N-[(3,4,5-trimethoxyphenyl)methylamino]carbamate |
|---|---|
| PubChem CID | 107237065 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | tert-butyl N-[(3,4,5-trimethoxyphenyl)methylamino]carbamate |
| SMILES | COc1cc(CNNC(=O)OC(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C15H24N2O5/c1-15(2,3)22-14(18)17-16-9-10-7-11(19-4)13(21-6)12(8-10)20-5/h7-8,16H,9H2,1-6H3,(H,17,18) |
| InChIKey | YSCZXITZFHFQKN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|