C17H25NO5 — CID 169468365
tert-butyl N-[3-(3,4,5-trimethoxyphenyl)prop-2-enyl]carbamate (PubChem CID 169468365) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is tert-butyl N-[3-(3,4,5-trimethoxyphenyl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(3,4,5-trimethoxyphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169468365 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | tert-butyl N-[3-(3,4,5-trimethoxyphenyl)prop-2-enyl]carbamate |
| SMILES | COc1cc(C=CCNC(=O)OC(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C17H25NO5/c1-17(2,3)23-16(19)18-9-7-8-12-10-13(20-4)15(22-6)14(11-12)21-5/h7-8,10-11H,9H2,1-6H3,(H,18,19) |
| InChIKey | RVORDPLAUJYKLS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |