C16H21NO4 — CID 171809039
methyl 3-[(E)-3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-enyl]benzoate (PubChem CID 171809039) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is methyl 3-[(E)-3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-enyl]benzoate.
| Compound Name | methyl 3-[(E)-3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 171809039 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | methyl 3-[(E)-3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-enyl]benzoate |
| SMILES | COC(=O)c1cccc(/C=C/CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C16H21NO4/c1-16(2,3)21-15(19)17-10-6-8-12-7-5-9-13(11-12)14(18)20-4/h5-9,11H,10H2,1-4H3,(H,17,19)/b8-6+ |
| InChIKey | KUIVEIGTXSDXNW-SOFGYWHQSA-N |
| XLogP | 3.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |