C21H27N3O5 — CID 171809365
tert-butyl N-[(E)-3-[3-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]phenyl]prop-2-enyl]carbamate (PubChem CID 171809365) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is tert-butyl N-[(E)-3-[3-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]phenyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-3-[3-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 171809365 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | tert-butyl N-[(E)-3-[3-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]phenyl]prop-2-enyl]carbamate |
| SMILES | CN(C(=O)c1cccc(/C=C/CNC(=O)OC(C)(C)C)c1)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C21H27N3O5/c1-21(2,3)29-20(28)22-12-6-8-14-7-5-9-15(13-14)19(27)24(4)16-10-11-17(25)23-18(16)26/h5-9,13,16H,10-12H2,1-4H3,(H,22,28)(H,23,25,26)/b8-6+ |
| InChIKey | SUSKOLTUCHKVJM-SOFGYWHQSA-N |
| XLogP | 2.10 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|