C23H31N3O7 — CID 166855337
tert-butyl 3-[2-[3-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]-2-formylanilino]ethoxy]propanoate (PubChem CID 166855337) has the molecular formula C23H31N3O7 and a molecular weight of 461.52 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]-2-formylanilino]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[3-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]-2-formylanilino]ethoxy]propanoate |
|---|---|
| PubChem CID | 166855337 |
| Molecular Formula | C23H31N3O7 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | tert-butyl 3-[2-[3-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]-2-formylanilino]ethoxy]propanoate |
| SMILES | CN(C(=O)c1cccc(NCCOCCC(=O)OC(C)(C)C)c1C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C23H31N3O7/c1-23(2,3)33-20(29)10-12-32-13-11-24-17-7-5-6-15(16(17)14-27)22(31)26(4)18-8-9-19(28)25-21(18)30/h5-7,14,18,24H,8-13H2,1-4H3,(H,25,28,30) |
| InChIKey | USEOOKBUHQTSQH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|