C22H27N3O5 — CID 167275653
1-N-(cyclohexylmethyl)-3-N-(2,6-dioxopiperidin-3-yl)-4-formyl-3-N-methylbenzene-1,3-dicarboxamide (PubChem CID 167275653) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 1-N-(cyclohexylmethyl)-3-N-(2,6-dioxopiperidin-3-yl)-4-formyl-3-N-methylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-(cyclohexylmethyl)-3-N-(2,6-dioxopiperidin-3-yl)-4-formyl-3-N-methylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 167275653 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 1-N-(cyclohexylmethyl)-3-N-(2,6-dioxopiperidin-3-yl)-4-formyl-3-N-methylbenzene-1,3-dicarboxamide |
| SMILES | CN(C(=O)c1cc(C(=O)NCC2CCCCC2)ccc1C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C22H27N3O5/c1-25(18-9-10-19(27)24-21(18)29)22(30)17-11-15(7-8-16(17)13-26)20(28)23-12-14-5-3-2-4-6-14/h7-8,11,13-14,18H,2-6,9-10,12H2,1H3,(H,23,28)(H,24,27,29) |
| InChIKey | UXDTXCLCJFQKRI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|