C24H31FN4O4 — CID 167091351
N-(2,6-dioxopiperidin-3-yl)-4-fluoro-2-formyl-N-methyl-5-(4-piperidin-4-ylpiperidin-1-yl)benzamide (PubChem CID 167091351) has the molecular formula C24H31FN4O4 and a molecular weight of 458.53 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-4-fluoro-2-formyl-N-methyl-5-(4-piperidin-4-ylpiperidin-1-yl)benzamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-4-fluoro-2-formyl-N-methyl-5-(4-piperidin-4-ylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 167091351 |
| Molecular Formula | C24H31FN4O4 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-4-fluoro-2-formyl-N-methyl-5-(4-piperidin-4-ylpiperidin-1-yl)benzamide |
| SMILES | CN(C(=O)c1cc(N2CCC(C3CCNCC3)CC2)c(F)cc1C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C24H31FN4O4/c1-28(20-2-3-22(31)27-23(20)32)24(33)18-13-21(19(25)12-17(18)14-30)29-10-6-16(7-11-29)15-4-8-26-9-5-15/h12-16,20,26H,2-11H2,1H3,(H,27,31,32) |
| InChIKey | KCFCYQZBPPDLSF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|