C18H22N4O4 — CID 170727208
(4aS)-N-(2,6-dioxopiperidin-3-yl)-N-methyl-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazine-8-carboxamide (PubChem CID 170727208) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is (4aS)-N-(2,6-dioxopiperidin-3-yl)-N-methyl-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazine-8-carboxamide.
| Compound Name | (4aS)-N-(2,6-dioxopiperidin-3-yl)-N-methyl-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazine-8-carboxamide |
|---|---|
| PubChem CID | 170727208 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (4aS)-N-(2,6-dioxopiperidin-3-yl)-N-methyl-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazine-8-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(c1)OC[C@@H]1CNCCN21)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H22N4O4/c1-21(14-4-5-16(23)20-17(14)24)18(25)11-2-3-13-15(8-11)26-10-12-9-19-6-7-22(12)13/h2-3,8,12,14,19H,4-7,9-10H2,1H3,(H,20,23,24)/t12-,14?/m0/s1 |
| InChIKey | OAGCMPHEBHIQAK-NBFOIZRFSA-N |
| XLogP | -0.27 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|