C13H17N3O2 — CID 171488301
2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][4,1]benzoxazepine-9-carboxamide (PubChem CID 171488301) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][4,1]benzoxazepine-9-carboxamide.
| Compound Name | 2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][4,1]benzoxazepine-9-carboxamide |
|---|---|
| PubChem CID | 171488301 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][4,1]benzoxazepine-9-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)COCC1CNCCN21 |
| InChI | InChI=1S/C13H17N3O2/c14-13(17)9-1-2-12-10(5-9)7-18-8-11-6-15-3-4-16(11)12/h1-2,5,11,15H,3-4,6-8H2,(H2,14,17) |
| InChIKey | NEODHJHLAKARCJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |