C13H16ClN3O — CID 63092111
4-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-chlorobenzamide (PubChem CID 63092111) has the molecular formula C13H16ClN3O and a molecular weight of 265.74 g/mol. Its IUPAC name is 4-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-chlorobenzamide.
| Compound Name | 4-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 63092111 |
| Molecular Formula | C13H16ClN3O |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-chlorobenzamide |
| SMILES | NC(=O)c1ccc(N2CC[C@H]3CNC[C@H]32)c(Cl)c1 |
| InChI | InChI=1S/C13H16ClN3O/c14-10-5-8(13(15)18)1-2-11(10)17-4-3-9-6-16-7-12(9)17/h1-2,5,9,12,16H,3-4,6-7H2,(H2,15,18)/t9-,12+/m0/s1 |
| InChIKey | KNIKRSJIQUKMBK-JOYOIKCWSA-N |
| XLogP | 1.24 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |