C15H19ClN2S — CID 82747165
4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-chlorobenzenecarbothioamide (PubChem CID 82747165) has the molecular formula C15H19ClN2S and a molecular weight of 294.85 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-chlorobenzenecarbothioamide.
| Compound Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-chlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 82747165 |
| Molecular Formula | C15H19ClN2S |
| Molecular Weight | 294.85 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-chlorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2CCC3CCCCC32)c(Cl)c1 |
| InChI | InChI=1S/C15H19ClN2S/c16-12-9-11(15(17)19)5-6-14(12)18-8-7-10-3-1-2-4-13(10)18/h5-6,9-10,13H,1-4,7-8H2,(H2,17,19) |
| InChIKey | RPMCOYPWOGMQPC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.85 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|