C12H15ClN2S — CID 63086947
3-chloro-4-(2-methylpyrrolidin-1-yl)benzenecarbothioamide (PubChem CID 63086947) has the molecular formula C12H15ClN2S and a molecular weight of 254.79 g/mol. Its IUPAC name is 3-chloro-4-(2-methylpyrrolidin-1-yl)benzenecarbothioamide.
| Compound Name | 3-chloro-4-(2-methylpyrrolidin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 63086947 |
| Molecular Formula | C12H15ClN2S |
| Molecular Weight | 254.79 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 3-chloro-4-(2-methylpyrrolidin-1-yl)benzenecarbothioamide |
| SMILES | CC1CCCN1c1ccc(C(N)=S)cc1Cl |
| InChI | InChI=1S/C12H15ClN2S/c1-8-3-2-6-15(8)11-5-4-9(12(14)16)7-10(11)13/h4-5,7-8H,2-3,6H2,1H3,(H2,14,16) |
| InChIKey | LYODBNFCLLRLNN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|