C13H16ClN3OS — CID 55180077
1-(4-carbamothioyl-2-chlorophenyl)piperidine-2-carboxamide (PubChem CID 55180077) has the molecular formula C13H16ClN3OS and a molecular weight of 297.81 g/mol. Its IUPAC name is 1-(4-carbamothioyl-2-chlorophenyl)piperidine-2-carboxamide.
| Compound Name | 1-(4-carbamothioyl-2-chlorophenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 55180077 |
| Molecular Formula | C13H16ClN3OS |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-(4-carbamothioyl-2-chlorophenyl)piperidine-2-carboxamide |
| SMILES | NC(=O)C1CCCCN1c1ccc(C(N)=S)cc1Cl |
| InChI | InChI=1S/C13H16ClN3OS/c14-9-7-8(13(16)19)4-5-10(9)17-6-2-1-3-11(17)12(15)18/h4-5,7,11H,1-3,6H2,(H2,15,18)(H2,16,19) |
| InChIKey | JPRFAVBTTRRULM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|