C12H13F2N3OS — CID 107934486
1-(4-carbamothioyl-2,3-difluorophenyl)pyrrolidine-2-carboxamide (PubChem CID 107934486) has the molecular formula C12H13F2N3OS and a molecular weight of 285.32 g/mol. Its IUPAC name is 1-(4-carbamothioyl-2,3-difluorophenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-carbamothioyl-2,3-difluorophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 107934486 |
| Molecular Formula | C12H13F2N3OS |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 1-(4-carbamothioyl-2,3-difluorophenyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1c1ccc(C(N)=S)c(F)c1F |
| InChI | InChI=1S/C12H13F2N3OS/c13-9-6(12(16)19)3-4-7(10(9)14)17-5-1-2-8(17)11(15)18/h3-4,8H,1-2,5H2,(H2,15,18)(H2,16,19) |
| InChIKey | KARUJJKQHVCSTD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|