C11H14FN3O2 — CID 170309100
(2R)-1-(3,4-diamino-2-fluorophenyl)pyrrolidine-2-carboxylic acid (PubChem CID 170309100) has the molecular formula C11H14FN3O2 and a molecular weight of 239.25 g/mol. Its IUPAC name is (2R)-1-(3,4-diamino-2-fluorophenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-(3,4-diamino-2-fluorophenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 170309100 |
| Molecular Formula | C11H14FN3O2 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (2R)-1-(3,4-diamino-2-fluorophenyl)pyrrolidine-2-carboxylic acid |
| SMILES | Nc1ccc(N2CCC[C@@H]2C(=O)O)c(F)c1N |
| InChI | InChI=1S/C11H14FN3O2/c12-9-7(4-3-6(13)10(9)14)15-5-1-2-8(15)11(16)17/h3-4,8H,1-2,5,13-14H2,(H,16,17)/t8-/m1/s1 |
| InChIKey | VWZPSQLOVXWDCL-MRVPVSSYSA-N |
| XLogP | 1.04 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|