C12H15IN2 — CID 70849566
(3aR,6aR)-1-(4-iodophenyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 70849566) has the molecular formula C12H15IN2 and a molecular weight of 314.17 g/mol. Its IUPAC name is (3aR,6aR)-1-(4-iodophenyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aR,6aR)-1-(4-iodophenyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 70849566 |
| Molecular Formula | C12H15IN2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | (3aR,6aR)-1-(4-iodophenyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | Ic1ccc(N2CC[C@@H]3CNC[C@@H]32)cc1 |
| InChI | InChI=1S/C12H15IN2/c13-10-1-3-11(4-2-10)15-6-5-9-7-14-8-12(9)15/h1-4,9,12,14H,5-8H2/t9-,12+/m1/s1 |
| InChIKey | RFVHMMOHMOCXBD-SKDRFNHKSA-N |
| XLogP | 2.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|