C12H13N3 — CID 162434267
1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole-8-carbonitrile (PubChem CID 162434267) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole-8-carbonitrile.
| Compound Name | 1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole-8-carbonitrile |
|---|---|
| PubChem CID | 162434267 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole-8-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CC1CNCCN21 |
| InChI | InChI=1S/C12H13N3/c13-7-9-1-2-12-10(5-9)6-11-8-14-3-4-15(11)12/h1-2,5,11,14H,3-4,6,8H2 |
| InChIKey | ASCIEFKEVPKMFY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |