C14H17N3 — CID 129388309
(2R)-2-piperazin-1-yl-2,3-dihydro-1H-indene-5-carbonitrile (PubChem CID 129388309) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is (2R)-2-piperazin-1-yl-2,3-dihydro-1H-indene-5-carbonitrile.
| Compound Name | (2R)-2-piperazin-1-yl-2,3-dihydro-1H-indene-5-carbonitrile |
|---|---|
| PubChem CID | 129388309 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | (2R)-2-piperazin-1-yl-2,3-dihydro-1H-indene-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C[C@H](N1CCNCC1)C2 |
| InChI | InChI=1S/C14H17N3/c15-10-11-1-2-12-8-14(9-13(12)7-11)17-5-3-16-4-6-17/h1-2,7,14,16H,3-6,8-9H2/t14-/m1/s1 |
| InChIKey | HVFCPSZDUUEFIO-CQSZACIVSA-N |
| XLogP | 0.93 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |